C9H19N3O2S2 — CID 61123835
2-(azepan-1-ylsulfonylamino)propanethioamide (PubChem CID 61123835) has the molecular formula C9H19N3O2S2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-(azepan-1-ylsulfonylamino)propanethioamide.
| Compound Name | 2-(azepan-1-ylsulfonylamino)propanethioamide |
|---|---|
| PubChem CID | 61123835 |
| Molecular Formula | C9H19N3O2S2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-(azepan-1-ylsulfonylamino)propanethioamide |
| SMILES | CC(NS(=O)(=O)N1CCCCCC1)C(N)=S |
| InChI | InChI=1S/C9H19N3O2S2/c1-8(9(10)15)11-16(13,14)12-6-4-2-3-5-7-12/h8,11H,2-7H2,1H3,(H2,10,15) |
| InChIKey | JOMCZIVJUGDFEJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|