C9H14F2N2O2S — CID 61123926
N-[cyano(cyclohexyl)methyl]-1,1-difluoromethanesulfonamide (PubChem CID 61123926) has the molecular formula C9H14F2N2O2S and a molecular weight of 252.29 g/mol. Its IUPAC name is N-[cyano(cyclohexyl)methyl]-1,1-difluoromethanesulfonamide.
| Compound Name | N-[cyano(cyclohexyl)methyl]-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 61123926 |
| Molecular Formula | C9H14F2N2O2S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-[cyano(cyclohexyl)methyl]-1,1-difluoromethanesulfonamide |
| SMILES | N#CC(NS(=O)(=O)C(F)F)C1CCCCC1 |
| InChI | InChI=1S/C9H14F2N2O2S/c10-9(11)16(14,15)13-8(6-12)7-4-2-1-3-5-7/h7-9,13H,1-5H2 |
| InChIKey | PDSDATNSNGYVKL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |