C14H25N3O2S — CID 61124093
N-(1-cyano-4-ethylcyclohexyl)piperidine-1-sulfonamide (PubChem CID 61124093) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is N-(1-cyano-4-ethylcyclohexyl)piperidine-1-sulfonamide.
| Compound Name | N-(1-cyano-4-ethylcyclohexyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 61124093 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | N-(1-cyano-4-ethylcyclohexyl)piperidine-1-sulfonamide |
| SMILES | CCC1CCC(C#N)(NS(=O)(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C14H25N3O2S/c1-2-13-6-8-14(12-15,9-7-13)16-20(18,19)17-10-4-3-5-11-17/h13,16H,2-11H2,1H3 |
| InChIKey | VQUDMJLWEWPCND-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |