C6H10F2N2O2S — CID 61124505
N-(2-cyanobutan-2-yl)-1,1-difluoromethanesulfonamide (PubChem CID 61124505) has the molecular formula C6H10F2N2O2S and a molecular weight of 212.22 g/mol. Its IUPAC name is N-(2-cyanobutan-2-yl)-1,1-difluoromethanesulfonamide.
| Compound Name | N-(2-cyanobutan-2-yl)-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 61124505 |
| Molecular Formula | C6H10F2N2O2S |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | N-(2-cyanobutan-2-yl)-1,1-difluoromethanesulfonamide |
| SMILES | CCC(C)(C#N)NS(=O)(=O)C(F)F |
| InChI | InChI=1S/C6H10F2N2O2S/c1-3-6(2,4-9)10-13(11,12)5(7)8/h5,10H,3H2,1-2H3 |
| InChIKey | WKOGRULGHGIZJK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |