C7H12F2N2O2S — CID 61124910
N-(3-cyanopentan-3-yl)-1,1-difluoromethanesulfonamide (PubChem CID 61124910) has the molecular formula C7H12F2N2O2S and a molecular weight of 226.25 g/mol. Its IUPAC name is N-(3-cyanopentan-3-yl)-1,1-difluoromethanesulfonamide.
| Compound Name | N-(3-cyanopentan-3-yl)-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 61124910 |
| Molecular Formula | C7H12F2N2O2S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | N-(3-cyanopentan-3-yl)-1,1-difluoromethanesulfonamide |
| SMILES | CCC(C#N)(CC)NS(=O)(=O)C(F)F |
| InChI | InChI=1S/C7H12F2N2O2S/c1-3-7(4-2,5-10)11-14(12,13)6(8)9/h6,11H,3-4H2,1-2H3 |
| InChIKey | YGLADHFGKKKYBE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |