C10H17F3N2O2S — CID 83059831
N-(3-cyanopentan-3-yl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 83059831) has the molecular formula C10H17F3N2O2S and a molecular weight of 286.32 g/mol. Its IUPAC name is N-(3-cyanopentan-3-yl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(3-cyanopentan-3-yl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 83059831 |
| Molecular Formula | C10H17F3N2O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-(3-cyanopentan-3-yl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | CCC(C#N)(CC)NS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O2S/c1-3-9(4-2,8-14)15-18(16,17)7-5-6-10(11,12)13/h15H,3-7H2,1-2H3 |
| InChIKey | DNMFDEXFGHDGSE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |