C10H19N3O2S2 — CID 61125054
1-(pyrrolidin-1-ylsulfonylamino)cyclopentane-1-carbothioamide (PubChem CID 61125054) has the molecular formula C10H19N3O2S2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 1-(pyrrolidin-1-ylsulfonylamino)cyclopentane-1-carbothioamide.
| Compound Name | 1-(pyrrolidin-1-ylsulfonylamino)cyclopentane-1-carbothioamide |
|---|---|
| PubChem CID | 61125054 |
| Molecular Formula | C10H19N3O2S2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1-(pyrrolidin-1-ylsulfonylamino)cyclopentane-1-carbothioamide |
| SMILES | NC(=S)C1(NS(=O)(=O)N2CCCC2)CCCC1 |
| InChI | InChI=1S/C10H19N3O2S2/c11-9(16)10(5-1-2-6-10)12-17(14,15)13-7-3-4-8-13/h12H,1-8H2,(H2,11,16) |
| InChIKey | PXFXQNWVGSRUHS-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|