C14H15FN2O2S2 — CID 61127204
4-fluoro-3-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]aniline (PubChem CID 61127204) has the molecular formula C14H15FN2O2S2 and a molecular weight of 326.42 g/mol. Its IUPAC name is 4-fluoro-3-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]aniline.
| Compound Name | 4-fluoro-3-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]aniline |
|---|---|
| PubChem CID | 61127204 |
| Molecular Formula | C14H15FN2O2S2 |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 4-fluoro-3-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)sulfonyl]aniline |
| SMILES | CC1c2ccsc2CCN1S(=O)(=O)c1cc(N)ccc1F |
| InChI | InChI=1S/C14H15FN2O2S2/c1-9-11-5-7-20-13(11)4-6-17(9)21(18,19)14-8-10(16)2-3-12(14)15/h2-3,5,7-9H,4,6,16H2,1H3 |
| InChIKey | PZWQAKICEYZAQM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|