C10H14N2O2S — CID 61127702
2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)ethanethioamide (PubChem CID 61127702) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)ethanethioamide.
| Compound Name | 2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)ethanethioamide |
|---|---|
| PubChem CID | 61127702 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)ethanethioamide |
| SMILES | NC(=S)CN1C(=O)CC2(CCCC2)C1=O |
| InChI | InChI=1S/C10H14N2O2S/c11-7(15)6-12-8(13)5-10(9(12)14)3-1-2-4-10/h1-6H2,(H2,11,15) |
| InChIKey | ZCQMGJMNOBVINB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|