C14H15N3O3S — CID 61129781
N,6-dimethyl-N-(4-sulfamoylphenyl)pyridine-2-carboxamide (PubChem CID 61129781) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is N,6-dimethyl-N-(4-sulfamoylphenyl)pyridine-2-carboxamide.
| Compound Name | N,6-dimethyl-N-(4-sulfamoylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 61129781 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N,6-dimethyl-N-(4-sulfamoylphenyl)pyridine-2-carboxamide |
| SMILES | Cc1cccc(C(=O)N(C)c2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C14H15N3O3S/c1-10-4-3-5-13(16-10)14(18)17(2)11-6-8-12(9-7-11)21(15,19)20/h3-9H,1-2H3,(H2,15,19,20) |
| InChIKey | YOMOOUXMCBKKSM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |