C10H22N2 — CID 6114333
(E)-N,N,N',N'-tetraethylethene-1,2-diamine (PubChem CID 6114333) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is (E)-N,N,N',N'-tetraethylethene-1,2-diamine.
| Compound Name | (E)-N,N,N',N'-tetraethylethene-1,2-diamine |
|---|---|
| PubChem CID | 6114333 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | (E)-N,N,N',N'-tetraethylethene-1,2-diamine |
| SMILES | CCN(/C=C/N(CC)CC)CC |
| InChI | InChI=1S/C10H22N2/c1-5-11(6-2)9-10-12(7-3)8-4/h9-10H,5-8H2,1-4H3/b10-9+ |
| InChIKey | OSAXUDJOIOXQFR-MDZDMXLPSA-N |
| XLogP | 2.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |