C12H12N2O4S — CID 61143353
(2R)-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]-2-phenylacetic acid (PubChem CID 61143353) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is (2R)-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 61143353 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | (2R)-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]-2-phenylacetic acid |
| SMILES | O=C1NC(C(=O)N[C@@H](C(=O)O)c2ccccc2)CS1 |
| InChI | InChI=1S/C12H12N2O4S/c15-10(8-6-19-12(18)13-8)14-9(11(16)17)7-4-2-1-3-5-7/h1-5,8-9H,6H2,(H,13,18)(H,14,15)(H,16,17)/t8?,9-/m1/s1 |
| InChIKey | ACCRUFXXOBVTNH-YGPZHTELSA-N |
| XLogP | 0.75 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|