C15H18N2O2S — CID 99847856
(4R)-N-[(R)-[(1S,2R)-2-methylcyclopropyl]-phenylmethyl]-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 99847856) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is (4R)-N-[(R)-[(1S,2R)-2-methylcyclopropyl]-phenylmethyl]-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-N-[(R)-[(1S,2R)-2-methylcyclopropyl]-phenylmethyl]-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 99847856 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (4R)-N-[(R)-[(1S,2R)-2-methylcyclopropyl]-phenylmethyl]-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | C[C@@H]1C[C@@H]1[C@@H](NC(=O)[C@@H]1CSC(=O)N1)c1ccccc1 |
| InChI | InChI=1S/C15H18N2O2S/c1-9-7-11(9)13(10-5-3-2-4-6-10)17-14(18)12-8-20-15(19)16-12/h2-6,9,11-13H,7-8H2,1H3,(H,16,19)(H,17,18)/t9-,11+,12+,13+/m1/s1 |
| InChIKey | PWOACXUBRBGNCR-IXOXFDKPSA-N |
| XLogP | 2.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|