C18H18FNO — CID 86956041
2-fluoro-N-[(2-methylcyclopropyl)-phenylmethyl]benzamide (PubChem CID 86956041) has the molecular formula C18H18FNO and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-fluoro-N-[(2-methylcyclopropyl)-phenylmethyl]benzamide.
| Compound Name | 2-fluoro-N-[(2-methylcyclopropyl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 86956041 |
| Molecular Formula | C18H18FNO |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-fluoro-N-[(2-methylcyclopropyl)-phenylmethyl]benzamide |
| SMILES | CC1CC1C(NC(=O)c1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C18H18FNO/c1-12-11-15(12)17(13-7-3-2-4-8-13)20-18(21)14-9-5-6-10-16(14)19/h2-10,12,15,17H,11H2,1H3,(H,20,21) |
| InChIKey | DVVGPLGNPLLOGV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |