C19H19F2NO3S — CID 86956089
4-(difluoromethylsulfonyl)-N-[(2-methylcyclopropyl)-phenylmethyl]benzamide (PubChem CID 86956089) has the molecular formula C19H19F2NO3S and a molecular weight of 379.43 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[(2-methylcyclopropyl)-phenylmethyl]benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[(2-methylcyclopropyl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 86956089 |
| Molecular Formula | C19H19F2NO3S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[(2-methylcyclopropyl)-phenylmethyl]benzamide |
| SMILES | CC1CC1C(NC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H19F2NO3S/c1-12-11-16(12)17(13-5-3-2-4-6-13)22-18(23)14-7-9-15(10-8-14)26(24,25)19(20)21/h2-10,12,16-17,19H,11H2,1H3,(H,22,23) |
| InChIKey | GRRXFHZXLWMIHV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |