C22H26F2N2O3S — CID 60551422
4-(difluoromethylsulfonyl)-N-[2-(4-methylpiperidin-1-yl)-2-phenylethyl]benzamide (PubChem CID 60551422) has the molecular formula C22H26F2N2O3S and a molecular weight of 436.52 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[2-(4-methylpiperidin-1-yl)-2-phenylethyl]benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[2-(4-methylpiperidin-1-yl)-2-phenylethyl]benzamide |
|---|---|
| PubChem CID | 60551422 |
| Molecular Formula | C22H26F2N2O3S |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[2-(4-methylpiperidin-1-yl)-2-phenylethyl]benzamide |
| SMILES | CC1CCN(C(CNC(=O)c2ccc(S(=O)(=O)C(F)F)cc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H26F2N2O3S/c1-16-11-13-26(14-12-16)20(17-5-3-2-4-6-17)15-25-21(27)18-7-9-19(10-8-18)30(28,29)22(23)24/h2-10,16,20,22H,11-15H2,1H3,(H,25,27) |
| InChIKey | ZOODNUNLTGNKFE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |