C15H9Cl2NO2S — CID 6114880
(1Z)-1-[(2,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one (PubChem CID 6114880) has the molecular formula C15H9Cl2NO2S and a molecular weight of 338.22 g/mol. Its IUPAC name is (1Z)-1-[(2,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one.
| Compound Name | (1Z)-1-[(2,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 6114880 |
| Molecular Formula | C15H9Cl2NO2S |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | (1Z)-1-[(2,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one |
| SMILES | Cc1cc2c(c(=S)[nH]1)C(=O)O/C2=C\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H9Cl2NO2S/c1-7-4-10-12(20-15(19)13(10)14(21)18-7)5-8-2-3-9(16)6-11(8)17/h2-6H,1H3,(H,18,21)/b12-5- |
| InChIKey | DSBQBHLCPHLMNA-XGICHPGQSA-N |
| XLogP | 5.03 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_J(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|