C17H12I2N2O2S — CID 6115247
(5E)-3-[(2-iodoanilino)methyl]-5-[(4-iodophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 6115247) has the molecular formula C17H12I2N2O2S and a molecular weight of 562.17 g/mol. Its IUPAC name is (5E)-3-[(2-iodoanilino)methyl]-5-[(4-iodophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2-iodoanilino)methyl]-5-[(4-iodophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 6115247 |
| Molecular Formula | C17H12I2N2O2S |
| Molecular Weight | 562.17 g/mol |
| Exact Mass | 561.87 |
| IUPAC Name | (5E)-3-[(2-iodoanilino)methyl]-5-[(4-iodophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(I)cc2)C(=O)N1CNc1ccccc1I |
| InChI | InChI=1S/C17H12I2N2O2S/c18-12-7-5-11(6-8-12)9-15-16(22)21(17(23)24-15)10-20-14-4-2-1-3-13(14)19/h1-9,20H,10H2/b15-9+ |
| InChIKey | SDIJSFDARVSWQA-OQLLNIDSSA-N |
| XLogP | 5.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.17 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|