C19H15FN2O4S — CID 3560181
methyl 2-[[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methylamino]benzoate (PubChem CID 3560181) has the molecular formula C19H15FN2O4S and a molecular weight of 386.40 g/mol. Its IUPAC name is methyl 2-[[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methylamino]benzoate.
| Compound Name | methyl 2-[[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methylamino]benzoate |
|---|---|
| PubChem CID | 3560181 |
| Molecular Formula | C19H15FN2O4S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | methyl 2-[[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NCN1C(=O)SC(=Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C19H15FN2O4S/c1-26-18(24)14-4-2-3-5-15(14)21-11-22-17(23)16(27-19(22)25)10-12-6-8-13(20)9-7-12/h2-10,21H,11H2,1H3 |
| InChIKey | KFYDVMBRCAETEY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|