C15H20N2O2 — CID 61155795
[(2S)-2,3-dihydro-1H-indol-2-yl]-(3-ethylmorpholin-4-yl)methanone (PubChem CID 61155795) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is [(2S)-2,3-dihydro-1H-indol-2-yl]-(3-ethylmorpholin-4-yl)methanone.
| Compound Name | [(2S)-2,3-dihydro-1H-indol-2-yl]-(3-ethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 61155795 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | [(2S)-2,3-dihydro-1H-indol-2-yl]-(3-ethylmorpholin-4-yl)methanone |
| SMILES | CCC1COCCN1C(=O)[C@@H]1Cc2ccccc2N1 |
| InChI | InChI=1S/C15H20N2O2/c1-2-12-10-19-8-7-17(12)15(18)14-9-11-5-3-4-6-13(11)16-14/h3-6,12,14,16H,2,7-10H2,1H3/t12?,14-/m0/s1 |
| InChIKey | ARTOZNVNHKMCHB-PYMCNQPYSA-N |
| XLogP | 1.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |