C14H28N2O — CID 61168818
N-cyclohexyl-2-(2,2-dimethylpropylamino)propanamide (PubChem CID 61168818) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is N-cyclohexyl-2-(2,2-dimethylpropylamino)propanamide.
| Compound Name | N-cyclohexyl-2-(2,2-dimethylpropylamino)propanamide |
|---|---|
| PubChem CID | 61168818 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | N-cyclohexyl-2-(2,2-dimethylpropylamino)propanamide |
| SMILES | CC(NCC(C)(C)C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H28N2O/c1-11(15-10-14(2,3)4)13(17)16-12-8-6-5-7-9-12/h11-12,15H,5-10H2,1-4H3,(H,16,17) |
| InChIKey | CZZRGCMVFQIOGW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |