C15H18N2S2 — CID 61170826
2-cyclopentylsulfanyl-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 61170826) has the molecular formula C15H18N2S2 and a molecular weight of 290.46 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 2-cyclopentylsulfanyl-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 61170826 |
| Molecular Formula | C15H18N2S2 |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-cyclopentylsulfanyl-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | c1ccc(SC2CCCC2)c(NCc2cscn2)c1 |
| InChI | InChI=1S/C15H18N2S2/c1-2-6-13(5-1)19-15-8-4-3-7-14(15)16-9-12-10-18-11-17-12/h3-4,7-8,10-11,13,16H,1-2,5-6,9H2 |
| InChIKey | GXEWJYBOARBAGC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |