C9H9N3OS — CID 130778586
3-(1,3-thiazol-4-ylmethylamino)-1H-pyridin-2-one (PubChem CID 130778586) has the molecular formula C9H9N3OS and a molecular weight of 207.26 g/mol. Its IUPAC name is 3-(1,3-thiazol-4-ylmethylamino)-1H-pyridin-2-one.
| Compound Name | 3-(1,3-thiazol-4-ylmethylamino)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130778586 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 3-(1,3-thiazol-4-ylmethylamino)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cccc1NCc1cscn1 |
| InChI | InChI=1S/C9H9N3OS/c13-9-8(2-1-3-10-9)11-4-7-5-14-6-12-7/h1-3,5-6,11H,4H2,(H,10,13) |
| InChIKey | VOLMNBRRPRIRLO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |