C11H10F3NO4 — CID 61170982
2-[methyl(2,2,2-trifluoroethoxycarbonyl)amino]benzoic acid (PubChem CID 61170982) has the molecular formula C11H10F3NO4 and a molecular weight of 277.20 g/mol. Its IUPAC name is 2-[methyl(2,2,2-trifluoroethoxycarbonyl)amino]benzoic acid.
| Compound Name | 2-[methyl(2,2,2-trifluoroethoxycarbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 61170982 |
| Molecular Formula | C11H10F3NO4 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-[methyl(2,2,2-trifluoroethoxycarbonyl)amino]benzoic acid |
| SMILES | CN(C(=O)OCC(F)(F)F)c1ccccc1C(=O)O |
| InChI | InChI=1S/C11H10F3NO4/c1-15(10(18)19-6-11(12,13)14)8-5-3-2-4-7(8)9(16)17/h2-5H,6H2,1H3,(H,16,17) |
| InChIKey | PITOAIYWDRXZPB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |