C13H21N3O5 — CID 61173447
(2S)-2-[[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]-3-methylpentanoic acid (PubChem CID 61173447) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is (2S)-2-[[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 61173447 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (2S)-2-[[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)[C@H](NC(=O)CN1C(=O)NC(C)(C)C1=O)C(=O)O |
| InChI | InChI=1S/C13H21N3O5/c1-5-7(2)9(10(18)19)14-8(17)6-16-11(20)13(3,4)15-12(16)21/h7,9H,5-6H2,1-4H3,(H,14,17)(H,15,21)(H,18,19)/t7?,9-/m0/s1 |
| InChIKey | CBZXCIXRKCZLNH-NETXQHHPSA-N |
| XLogP | -0.07 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|