C19H18BrN3O3S — CID 6117603
(E)-N-[[(3-bromo-4-methylbenzoyl)amino]carbamothioyl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 6117603) has the molecular formula C19H18BrN3O3S and a molecular weight of 448.34 g/mol. Its IUPAC name is (E)-N-[[(3-bromo-4-methylbenzoyl)amino]carbamothioyl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[(3-bromo-4-methylbenzoyl)amino]carbamothioyl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6117603 |
| Molecular Formula | C19H18BrN3O3S |
| Molecular Weight | 448.34 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | (E)-N-[[(3-bromo-4-methylbenzoyl)amino]carbamothioyl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(=S)NNC(=O)c2ccc(C)c(Br)c2)cc1 |
| InChI | InChI=1S/C19H18BrN3O3S/c1-12-3-7-14(11-16(12)20)18(25)22-23-19(27)21-17(24)10-6-13-4-8-15(26-2)9-5-13/h3-11H,1-2H3,(H,22,25)(H2,21,23,24,27)/b10-6+ |
| InChIKey | YXJSQNCAMNHIMY-UXBLZVDNSA-N |
| XLogP | 3.12 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|