C14H18BrN3O2S — CID 2224963
N-[[(3-bromo-4-methylbenzoyl)amino]carbamothioyl]pentanamide (PubChem CID 2224963) has the molecular formula C14H18BrN3O2S and a molecular weight of 372.29 g/mol. Its IUPAC name is N-[[(3-bromo-4-methylbenzoyl)amino]carbamothioyl]pentanamide.
| Compound Name | N-[[(3-bromo-4-methylbenzoyl)amino]carbamothioyl]pentanamide |
|---|---|
| PubChem CID | 2224963 |
| Molecular Formula | C14H18BrN3O2S |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | N-[[(3-bromo-4-methylbenzoyl)amino]carbamothioyl]pentanamide |
| SMILES | CCCCC(=O)NC(=S)NNC(=O)c1ccc(C)c(Br)c1 |
| InChI | InChI=1S/C14H18BrN3O2S/c1-3-4-5-12(19)16-14(21)18-17-13(20)10-7-6-9(2)11(15)8-10/h6-8H,3-5H2,1-2H3,(H,17,20)(H2,16,18,19,21) |
| InChIKey | IKWFPNYZGIDRLE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|