C12H14BrN3OS — CID 26169670
1-[(3-bromo-4-methylbenzoyl)amino]-3-prop-2-enylthiourea (PubChem CID 26169670) has the molecular formula C12H14BrN3OS and a molecular weight of 328.24 g/mol. Its IUPAC name is 1-[(3-bromo-4-methylbenzoyl)amino]-3-prop-2-enylthiourea.
| Compound Name | 1-[(3-bromo-4-methylbenzoyl)amino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 26169670 |
| Molecular Formula | C12H14BrN3OS |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 1-[(3-bromo-4-methylbenzoyl)amino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NNC(=O)c1ccc(C)c(Br)c1 |
| InChI | InChI=1S/C12H14BrN3OS/c1-3-6-14-12(18)16-15-11(17)9-5-4-8(2)10(13)7-9/h3-5,7H,1,6H2,2H3,(H,15,17)(H2,14,16,18) |
| InChIKey | SJCCJLBXFJERHJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|