C10H9N5 — CID 61176623
4-(3-amino-1,2,4-triazol-1-yl)-3-methylbenzonitrile (PubChem CID 61176623) has the molecular formula C10H9N5 and a molecular weight of 199.22 g/mol. Its IUPAC name is 4-(3-amino-1,2,4-triazol-1-yl)-3-methylbenzonitrile.
| Compound Name | 4-(3-amino-1,2,4-triazol-1-yl)-3-methylbenzonitrile |
|---|---|
| PubChem CID | 61176623 |
| Molecular Formula | C10H9N5 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 4-(3-amino-1,2,4-triazol-1-yl)-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1-n1cnc(N)n1 |
| InChI | InChI=1S/C10H9N5/c1-7-4-8(5-11)2-3-9(7)15-6-13-10(12)14-15/h2-4,6H,1H3,(H2,12,14) |
| InChIKey | SJPZSFMPQBLBEY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |