C14H22N4O — CID 61176917
2-(2,2-dimethylmorpholin-4-yl)-4,6-dimethylpyridine-3-carboximidamide (PubChem CID 61176917) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-(2,2-dimethylmorpholin-4-yl)-4,6-dimethylpyridine-3-carboximidamide.
| Compound Name | 2-(2,2-dimethylmorpholin-4-yl)-4,6-dimethylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 61176917 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2-(2,2-dimethylmorpholin-4-yl)-4,6-dimethylpyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)cc(C)nc1N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C14H22N4O/c1-9-7-10(2)17-13(11(9)12(15)16)18-5-6-19-14(3,4)8-18/h7H,5-6,8H2,1-4H3,(H3,15,16) |
| InChIKey | ONGSEEIIJSVQFP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|