C14H21ClN2O — CID 61256841
4-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-2,2-dimethylmorpholine (PubChem CID 61256841) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is 4-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-2,2-dimethylmorpholine.
| Compound Name | 4-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 61256841 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-2,2-dimethylmorpholine |
| SMILES | Cc1cc(C)c(CCl)c(N2CCOC(C)(C)C2)n1 |
| InChI | InChI=1S/C14H21ClN2O/c1-10-7-11(2)16-13(12(10)8-15)17-5-6-18-14(3,4)9-17/h7H,5-6,8-9H2,1-4H3 |
| InChIKey | BCYGOADNHRJCIC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|