C16H24ClN3 — CID 79174406
3-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-9-methyl-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 79174406) has the molecular formula C16H24ClN3 and a molecular weight of 293.84 g/mol. Its IUPAC name is 3-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-9-methyl-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 3-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-9-methyl-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 79174406 |
| Molecular Formula | C16H24ClN3 |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 3-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-9-methyl-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | Cc1cc(C)c(CCl)c(N2CCC3CCC(C2)N3C)n1 |
| InChI | InChI=1S/C16H24ClN3/c1-11-8-12(2)18-16(15(11)9-17)20-7-6-13-4-5-14(10-20)19(13)3/h8,13-14H,4-7,9-10H2,1-3H3 |
| InChIKey | ZHGSMWFWMHMTPA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|