C14H19ClF3N3 — CID 62968990
1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-4-(2,2,2-trifluoroethyl)piperazine (PubChem CID 62968990) has the molecular formula C14H19ClF3N3 and a molecular weight of 321.77 g/mol. Its IUPAC name is 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-4-(2,2,2-trifluoroethyl)piperazine.
| Compound Name | 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-4-(2,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 62968990 |
| Molecular Formula | C14H19ClF3N3 |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-4-(2,2,2-trifluoroethyl)piperazine |
| SMILES | Cc1cc(C)c(CCl)c(N2CCN(CC(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C14H19ClF3N3/c1-10-7-11(2)19-13(12(10)8-15)21-5-3-20(4-6-21)9-14(16,17)18/h7H,3-6,8-9H2,1-2H3 |
| InChIKey | NOASTWQONRYJFA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|