C15H23ClN2 — CID 62932297
3-(chloromethyl)-2-(4,4-dimethylpiperidin-1-yl)-4,6-dimethylpyridine (PubChem CID 62932297) has the molecular formula C15H23ClN2 and a molecular weight of 266.82 g/mol. Its IUPAC name is 3-(chloromethyl)-2-(4,4-dimethylpiperidin-1-yl)-4,6-dimethylpyridine.
| Compound Name | 3-(chloromethyl)-2-(4,4-dimethylpiperidin-1-yl)-4,6-dimethylpyridine |
|---|---|
| PubChem CID | 62932297 |
| Molecular Formula | C15H23ClN2 |
| Molecular Weight | 266.82 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 3-(chloromethyl)-2-(4,4-dimethylpiperidin-1-yl)-4,6-dimethylpyridine |
| SMILES | Cc1cc(C)c(CCl)c(N2CCC(C)(C)CC2)n1 |
| InChI | InChI=1S/C15H23ClN2/c1-11-9-12(2)17-14(13(11)10-16)18-7-5-15(3,4)6-8-18/h9H,5-8,10H2,1-4H3 |
| InChIKey | UDVQGSLLFOBJMT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.82 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|