C13H18FN3O2S — CID 61180681
3-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-5-fluoro-4-methylbenzamide (PubChem CID 61180681) has the molecular formula C13H18FN3O2S and a molecular weight of 299.37 g/mol. Its IUPAC name is 3-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-5-fluoro-4-methylbenzamide.
| Compound Name | 3-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-5-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 61180681 |
| Molecular Formula | C13H18FN3O2S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 3-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-5-fluoro-4-methylbenzamide |
| SMILES | CSCC[C@H](N)C(=O)Nc1cc(C(N)=O)cc(F)c1C |
| InChI | InChI=1S/C13H18FN3O2S/c1-7-9(14)5-8(12(16)18)6-11(7)17-13(19)10(15)3-4-20-2/h5-6,10H,3-4,15H2,1-2H3,(H2,16,18)(H,17,19)/t10-/m0/s1 |
| InChIKey | SXZWYLQUSQWAAA-JTQLQIEISA-N |
| XLogP | 1.25 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |