C14H19N3O3 — CID 61186798
2-[methyl-(4-methylpiperazine-1-carbonyl)amino]benzoic acid (PubChem CID 61186798) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-[methyl-(4-methylpiperazine-1-carbonyl)amino]benzoic acid.
| Compound Name | 2-[methyl-(4-methylpiperazine-1-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 61186798 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2-[methyl-(4-methylpiperazine-1-carbonyl)amino]benzoic acid |
| SMILES | CN1CCN(C(=O)N(C)c2ccccc2C(=O)O)CC1 |
| InChI | InChI=1S/C14H19N3O3/c1-15-7-9-17(10-8-15)14(20)16(2)12-6-4-3-5-11(12)13(18)19/h3-6H,7-10H2,1-2H3,(H,18,19) |
| InChIKey | LJIZAODFYKKYCV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |