C14H18N2O4 — CID 62968689
2-[methyl(1,4-oxazepane-4-carbonyl)amino]benzoic acid (PubChem CID 62968689) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[methyl(1,4-oxazepane-4-carbonyl)amino]benzoic acid.
| Compound Name | 2-[methyl(1,4-oxazepane-4-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 62968689 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-[methyl(1,4-oxazepane-4-carbonyl)amino]benzoic acid |
| SMILES | CN(C(=O)N1CCCOCC1)c1ccccc1C(=O)O |
| InChI | InChI=1S/C14H18N2O4/c1-15(12-6-3-2-5-11(12)13(17)18)14(19)16-7-4-9-20-10-8-16/h2-3,5-6H,4,7-10H2,1H3,(H,17,18) |
| InChIKey | BEFDKGPVCAIAMP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |