C7H13N3O4 — CID 61187828
3-[(2-amino-2-oxoethyl)carbamoyl-methylamino]propanoic acid (PubChem CID 61187828) has the molecular formula C7H13N3O4 and a molecular weight of 203.20 g/mol. Its IUPAC name is 3-[(2-amino-2-oxoethyl)carbamoyl-methylamino]propanoic acid.
| Compound Name | 3-[(2-amino-2-oxoethyl)carbamoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 61187828 |
| Molecular Formula | C7H13N3O4 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 3-[(2-amino-2-oxoethyl)carbamoyl-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)NCC(N)=O |
| InChI | InChI=1S/C7H13N3O4/c1-10(3-2-6(12)13)7(14)9-4-5(8)11/h2-4H2,1H3,(H2,8,11)(H,9,14)(H,12,13) |
| InChIKey | GVFLKXMGMDWNLA-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |