C13H14Cl2N2O4 — CID 61188726
3,5-dichloro-2-[(2-methylmorpholine-4-carbonyl)amino]benzoic acid (PubChem CID 61188726) has the molecular formula C13H14Cl2N2O4 and a molecular weight of 333.17 g/mol. Its IUPAC name is 3,5-dichloro-2-[(2-methylmorpholine-4-carbonyl)amino]benzoic acid.
| Compound Name | 3,5-dichloro-2-[(2-methylmorpholine-4-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 61188726 |
| Molecular Formula | C13H14Cl2N2O4 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 3,5-dichloro-2-[(2-methylmorpholine-4-carbonyl)amino]benzoic acid |
| SMILES | CC1CN(C(=O)Nc2c(Cl)cc(Cl)cc2C(=O)O)CCO1 |
| InChI | InChI=1S/C13H14Cl2N2O4/c1-7-6-17(2-3-21-7)13(20)16-11-9(12(18)19)4-8(14)5-10(11)15/h4-5,7H,2-3,6H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | DPVJUFIVHPQZQU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |