C29H29N3O7S — CID 6119091
prop-2-enyl (2Z)-5-(4-butoxy-3-methoxyphenyl)-7-methyl-2-[(2-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 6119091) has the molecular formula C29H29N3O7S and a molecular weight of 563.63 g/mol. Its IUPAC name is prop-2-enyl (2Z)-5-(4-butoxy-3-methoxyphenyl)-7-methyl-2-[(2-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | prop-2-enyl (2Z)-5-(4-butoxy-3-methoxyphenyl)-7-methyl-2-[(2-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 6119091 |
| Molecular Formula | C29H29N3O7S |
| Molecular Weight | 563.63 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | prop-2-enyl (2Z)-5-(4-butoxy-3-methoxyphenyl)-7-methyl-2-[(2-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)N=c2s/c(=C\c3ccccc3[N+](=O)[O-])c(=O)n2C1c1ccc(OCCCC)c(OC)c1 |
| InChI | InChI=1S/C29H29N3O7S/c1-5-7-15-38-22-13-12-20(16-23(22)37-4)26-25(28(34)39-14-6-2)18(3)30-29-31(26)27(33)24(40-29)17-19-10-8-9-11-21(19)32(35)36/h6,8-13,16-17,26H,2,5,7,14-15H2,1,3-4H3/b24-17- |
| InChIKey | JCVWDJVAKLPCSF-ULJHMMPZSA-N |
| XLogP | 4.06 |
| TPSA | 122.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|