C28H30N2O5S2 — CID 6168001
prop-2-enyl (2Z)-5-(3-methoxy-4-pentoxyphenyl)-7-methyl-3-oxo-2-(thiophen-2-ylmethylidene)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 6168001) has the molecular formula C28H30N2O5S2 and a molecular weight of 538.69 g/mol. Its IUPAC name is prop-2-enyl (2Z)-5-(3-methoxy-4-pentoxyphenyl)-7-methyl-3-oxo-2-(thiophen-2-ylmethylidene)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | prop-2-enyl (2Z)-5-(3-methoxy-4-pentoxyphenyl)-7-methyl-3-oxo-2-(thiophen-2-ylmethylidene)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 6168001 |
| Molecular Formula | C28H30N2O5S2 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | prop-2-enyl (2Z)-5-(3-methoxy-4-pentoxyphenyl)-7-methyl-3-oxo-2-(thiophen-2-ylmethylidene)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)N=c2s/c(=C\c3cccs3)c(=O)n2C1c1ccc(OCCCCC)c(OC)c1 |
| InChI | InChI=1S/C28H30N2O5S2/c1-5-7-8-14-34-21-12-11-19(16-22(21)33-4)25-24(27(32)35-13-6-2)18(3)29-28-30(25)26(31)23(37-28)17-20-10-9-15-36-20/h6,9-12,15-17,25H,2,5,7-8,13-14H2,1,3-4H3/b23-17- |
| InChIKey | UVAIOSUUTBNTKA-QJOMJCCJSA-N |
| XLogP | 4.60 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|