C13H16FN3O2S2 — CID 61193213
3-amino-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-fluorobenzenesulfonamide (PubChem CID 61193213) has the molecular formula C13H16FN3O2S2 and a molecular weight of 329.42 g/mol. Its IUPAC name is 3-amino-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-fluorobenzenesulfonamide.
| Compound Name | 3-amino-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 61193213 |
| Molecular Formula | C13H16FN3O2S2 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 3-amino-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-fluorobenzenesulfonamide |
| SMILES | Cc1nc(C)c(C(C)NS(=O)(=O)c2ccc(F)c(N)c2)s1 |
| InChI | InChI=1S/C13H16FN3O2S2/c1-7-13(20-9(3)16-7)8(2)17-21(18,19)10-4-5-11(14)12(15)6-10/h4-6,8,17H,15H2,1-3H3 |
| InChIKey | JKUKSOCVPLQTJY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|