C12H13ClN2O3 — CID 61193527
2-[3-chloro-N-(prop-2-enylcarbamoyl)anilino]acetic acid (PubChem CID 61193527) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is 2-[3-chloro-N-(prop-2-enylcarbamoyl)anilino]acetic acid.
| Compound Name | 2-[3-chloro-N-(prop-2-enylcarbamoyl)anilino]acetic acid |
|---|---|
| PubChem CID | 61193527 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-[3-chloro-N-(prop-2-enylcarbamoyl)anilino]acetic acid |
| SMILES | C=CCNC(=O)N(CC(=O)O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H13ClN2O3/c1-2-6-14-12(18)15(8-11(16)17)10-5-3-4-9(13)7-10/h2-5,7H,1,6,8H2,(H,14,18)(H,16,17) |
| InChIKey | CUEOETPJINORRH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|