C10H7ClF3NO3 — CID 54897844
2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid (PubChem CID 54897844) has the molecular formula C10H7ClF3NO3 and a molecular weight of 281.62 g/mol. Its IUPAC name is 2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid.
| Compound Name | 2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid |
|---|---|
| PubChem CID | 54897844 |
| Molecular Formula | C10H7ClF3NO3 |
| Molecular Weight | 281.62 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid |
| SMILES | O=C(O)CN(C(=O)C(F)(F)F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C10H7ClF3NO3/c11-6-2-1-3-7(4-6)15(5-8(16)17)9(18)10(12,13)14/h1-4H,5H2,(H,16,17) |
| InChIKey | CRGKGKDNENDEHL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.62 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |