2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid

C10H7ClF3NO3 — CID 54897844

IUPAC2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid
SMILESO=C(O)CN(C(=O)C(F)(F)F)c1cccc(Cl)c1
InChIInChI=1S/C10H7ClF3NO3/c11-6-2-1-3-7(4-6)15(5-8(16)17)9(18)10(12,13)14/h1-4H,5H2,(H,16,17)
InChIKeyCRGKGKDNENDEHL-UHFFFAOYSA-N
MW281.62 g/mol
LogP2.32
Rot. Bonds3

About 2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid

2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid (PubChem CID 54897844) has the molecular formula C10H7ClF3NO3 and a molecular weight of 281.62 g/mol. Its IUPAC name is 2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid.

Molecular Properties

Compound Name2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid
PubChem CID54897844
Molecular FormulaC10H7ClF3NO3
Molecular Weight281.62 g/mol
Exact Mass281.01
IUPAC Name2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid
SMILESO=C(O)CN(C(=O)C(F)(F)F)c1cccc(Cl)c1
InChIInChI=1S/C10H7ClF3NO3/c11-6-2-1-3-7(4-6)15(5-8(16)17)9(18)10(12,13)14/h1-4H,5H2,(H,16,17)
InChIKeyCRGKGKDNENDEHL-UHFFFAOYSA-N
XLogP2.32
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.62
LogP ≤ 52.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid?
The IUPAC name of 2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid (CID 54897844) is 2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid.
What is the SMILES notation for 2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid?
The canonical SMILES for 2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid is O=C(O)CN(C(=O)C(F)(F)F)c1cccc(Cl)c1.
What is the InChIKey of 2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid?
The InChIKey is CRGKGKDNENDEHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClF3NO3/c11-6-2-1-3-7(4-6)15(5-8(16)17)9(18)10(12,13)14/h1-4H,5H2,(H,16,17).
What are the key properties of 2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid?
2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid has a molecular weight of 281.62 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-N-(2,2,2-trifluoroacetyl)anilino)acetic acid is sourced from PubChem (CID 54897844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).