C15H21ClN2O3 — CID 115432306
2-(N-[2-(aminomethyl)-2-ethylbutanoyl]-3-chloroanilino)acetic acid (PubChem CID 115432306) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is 2-(N-[2-(aminomethyl)-2-ethylbutanoyl]-3-chloroanilino)acetic acid.
| Compound Name | 2-(N-[2-(aminomethyl)-2-ethylbutanoyl]-3-chloroanilino)acetic acid |
|---|---|
| PubChem CID | 115432306 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-(N-[2-(aminomethyl)-2-ethylbutanoyl]-3-chloroanilino)acetic acid |
| SMILES | CCC(CC)(CN)C(=O)N(CC(=O)O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-3-15(4-2,10-17)14(21)18(9-13(19)20)12-7-5-6-11(16)8-12/h5-8H,3-4,9-10,17H2,1-2H3,(H,19,20) |
| InChIKey | JCHLAUPDOLYCSJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |