C12H12N2OS — CID 611980
N-hydroxy-N'-(4-methylphenyl)thiophene-2-carboximidamide (PubChem CID 611980) has the molecular formula C12H12N2OS and a molecular weight of 232.31 g/mol. Its IUPAC name is N-hydroxy-N'-(4-methylphenyl)thiophene-2-carboximidamide.
| Compound Name | N-hydroxy-N'-(4-methylphenyl)thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 611980 |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | N-hydroxy-N'-(4-methylphenyl)thiophene-2-carboximidamide |
| SMILES | Cc1ccc(/N=C(\NO)c2cccs2)cc1 |
| InChI | InChI=1S/C12H12N2OS/c1-9-4-6-10(7-5-9)13-12(14-15)11-3-2-8-16-11/h2-8,15H,1H3,(H,13,14) |
| InChIKey | RIFGHSGQFSJYMW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|