C11H19N3O4S — CID 61198358
5-amino-2-[[methyl(thiolan-3-yl)carbamoyl]amino]-5-oxopentanoic acid (PubChem CID 61198358) has the molecular formula C11H19N3O4S and a molecular weight of 289.36 g/mol. Its IUPAC name is 5-amino-2-[[methyl(thiolan-3-yl)carbamoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[methyl(thiolan-3-yl)carbamoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 61198358 |
| Molecular Formula | C11H19N3O4S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 5-amino-2-[[methyl(thiolan-3-yl)carbamoyl]amino]-5-oxopentanoic acid |
| SMILES | CN(C(=O)NC(CCC(N)=O)C(=O)O)C1CCSC1 |
| InChI | InChI=1S/C11H19N3O4S/c1-14(7-4-5-19-6-7)11(18)13-8(10(16)17)2-3-9(12)15/h7-8H,2-6H2,1H3,(H2,12,15)(H,13,18)(H,16,17) |
| InChIKey | DVHJGGKJIGTGDS-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |