C12H22N4O4 — CID 61408490
5-amino-2-[[methyl(piperidin-4-yl)carbamoyl]amino]-5-oxopentanoic acid (PubChem CID 61408490) has the molecular formula C12H22N4O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 5-amino-2-[[methyl(piperidin-4-yl)carbamoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[methyl(piperidin-4-yl)carbamoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 61408490 |
| Molecular Formula | C12H22N4O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 5-amino-2-[[methyl(piperidin-4-yl)carbamoyl]amino]-5-oxopentanoic acid |
| SMILES | CN(C(=O)NC(CCC(N)=O)C(=O)O)C1CCNCC1 |
| InChI | InChI=1S/C12H22N4O4/c1-16(8-4-6-14-7-5-8)12(20)15-9(11(18)19)2-3-10(13)17/h8-9,14H,2-7H2,1H3,(H2,13,17)(H,15,20)(H,18,19) |
| InChIKey | WKYFGHJKQAGUTB-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |