C12H21N3O4 — CID 61160975
(2S)-5-amino-5-oxo-2-[(2-piperidin-4-ylacetyl)amino]pentanoic acid (PubChem CID 61160975) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is (2S)-5-amino-5-oxo-2-[(2-piperidin-4-ylacetyl)amino]pentanoic acid.
| Compound Name | (2S)-5-amino-5-oxo-2-[(2-piperidin-4-ylacetyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 61160975 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | (2S)-5-amino-5-oxo-2-[(2-piperidin-4-ylacetyl)amino]pentanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)CC1CCNCC1)C(=O)O |
| InChI | InChI=1S/C12H21N3O4/c13-10(16)2-1-9(12(18)19)15-11(17)7-8-3-5-14-6-4-8/h8-9,14H,1-7H2,(H2,13,16)(H,15,17)(H,18,19)/t9-/m0/s1 |
| InChIKey | REMOZQZEXQKSSC-VIFPVBQESA-N |
| XLogP | -0.79 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |