C14H22N2O4 — CID 107830054
(2R)-5-amino-2-[[2-(2-bicyclo[2.2.1]heptanyl)acetyl]amino]-5-oxopentanoic acid (PubChem CID 107830054) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is (2R)-5-amino-2-[[2-(2-bicyclo[2.2.1]heptanyl)acetyl]amino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-[[2-(2-bicyclo[2.2.1]heptanyl)acetyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107830054 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (2R)-5-amino-2-[[2-(2-bicyclo[2.2.1]heptanyl)acetyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@@H](NC(=O)CC1CC2CCC1C2)C(=O)O |
| InChI | InChI=1S/C14H22N2O4/c15-12(17)4-3-11(14(19)20)16-13(18)7-10-6-8-1-2-9(10)5-8/h8-11H,1-7H2,(H2,15,17)(H,16,18)(H,19,20)/t8?,9?,10?,11-/m1/s1 |
| InChIKey | QQGYLLFDHICSTN-AHELAYONSA-N |
| XLogP | 0.65 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |